C29H33F3N4O5S — CID 18972075
[6-[2-(1-methylpyrazol-4-yl)ethylamino]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(3-propoxyphenyl)methanone;trifluoromethanesulfonic acid (PubChem CID 18972075) has the molecular formula C29H33F3N4O5S and a molecular weight of 606.67 g/mol. Its IUPAC name is [6-[2-(1-methylpyrazol-4-yl)ethylamino]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(3-propoxyphenyl)methanone;trifluoromethanesulfonic acid.
| Compound Name | [6-[2-(1-methylpyrazol-4-yl)ethylamino]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(3-propoxyphenyl)methanone;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 18972075 |
| Molecular Formula | C29H33F3N4O5S |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | [6-[2-(1-methylpyrazol-4-yl)ethylamino]-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-(3-propoxyphenyl)methanone;trifluoromethanesulfonic acid |
| SMILES | CCCOc1cccc(C(=O)c2ccc3[nH]c4c(c3c2)CC(NCCc2cnn(C)c2)CC4)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C28H32N4O2.CHF3O3S/c1-3-13-34-23-6-4-5-20(14-23)28(33)21-7-9-26-24(15-21)25-16-22(8-10-27(25)31-26)29-12-11-19-17-30-32(2)18-19;2-1(3,4)8(5,6)7/h4-7,9,14-15,17-18,22,29,31H,3,8,10-13,16H2,1-2H3;(H,5,6,7) |
| InChIKey | VEJGHIAHXRBFKI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|