C10H16NO2PS2 — CID 18978336
2-[hydroxy(sulfanyl)phosphinothioyl]oxy-N,N-dimethyl-2-phenylethanamine (PubChem CID 18978336) has the molecular formula C10H16NO2PS2 and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[hydroxy(sulfanyl)phosphinothioyl]oxy-N,N-dimethyl-2-phenylethanamine.
| Compound Name | 2-[hydroxy(sulfanyl)phosphinothioyl]oxy-N,N-dimethyl-2-phenylethanamine |
|---|---|
| PubChem CID | 18978336 |
| Molecular Formula | C10H16NO2PS2 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[hydroxy(sulfanyl)phosphinothioyl]oxy-N,N-dimethyl-2-phenylethanamine |
| SMILES | CN(C)CC(OP(O)(=S)S)c1ccccc1 |
| InChI | InChI=1S/C10H16NO2PS2/c1-11(2)8-10(13-14(12,15)16)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H2,12,15,16) |
| InChIKey | XIISIXAYESEELC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|