C11H10N2O — CID 18995591
N-but-1-ynyl-1,3-benzoxazol-2-amine (PubChem CID 18995591) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is N-but-1-ynyl-1,3-benzoxazol-2-amine.
| Compound Name | N-but-1-ynyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 18995591 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | N-but-1-ynyl-1,3-benzoxazol-2-amine |
| SMILES | CCC#CNc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H10N2O/c1-2-3-8-12-11-13-9-6-4-5-7-10(9)14-11/h4-7H,2H2,1H3,(H,12,13) |
| InChIKey | RRLXVMUXFRAWSW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|