C7H11Cl2N3O — CID 19024995
2-butoxy-1,2-dichloro-1,3,5-triazine (PubChem CID 19024995) has the molecular formula C7H11Cl2N3O and a molecular weight of 224.09 g/mol. Its IUPAC name is 2-butoxy-1,2-dichloro-1,3,5-triazine.
| Compound Name | 2-butoxy-1,2-dichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 19024995 |
| Molecular Formula | C7H11Cl2N3O |
| Molecular Weight | 224.09 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-butoxy-1,2-dichloro-1,3,5-triazine |
| SMILES | CCCCOC1(Cl)N=CN=CN1Cl |
| InChI | InChI=1S/C7H11Cl2N3O/c1-2-3-4-13-7(8)11-5-10-6-12(7)9/h5-6H,2-4H2,1H3 |
| InChIKey | BZWGPPRZDIWNBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|