C22H38N2O2 — CID 19028248
N,N-di(propan-2-yl)formamide;N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine (PubChem CID 19028248) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is N,N-di(propan-2-yl)formamide;N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | N,N-di(propan-2-yl)formamide;N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 19028248 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | N,N-di(propan-2-yl)formamide;N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine |
| SMILES | CC(C)N(C=O)C(C)C.CCCN(CCC)C1COc2ccccc2C1 |
| InChI | InChI=1S/C15H23NO.C7H15NO/c1-3-9-16(10-4-2)14-11-13-7-5-6-8-15(13)17-12-14;1-6(2)8(5-9)7(3)4/h5-8,14H,3-4,9-12H2,1-2H3;5-7H,1-4H3 |
| InChIKey | TZODKQOXIILPNX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|