C37H36N2O11 — CID 19033440
2-[4-[4-(2-amino-5-nitro-4-octoxyphenyl)benzoyl]oxyphenyl]-6-methoxycarbonylterephthalic acid (PubChem CID 19033440) has the molecular formula C37H36N2O11 and a molecular weight of 684.70 g/mol. Its IUPAC name is 2-[4-[4-(2-amino-5-nitro-4-octoxyphenyl)benzoyl]oxyphenyl]-6-methoxycarbonylterephthalic acid.
| Compound Name | 2-[4-[4-(2-amino-5-nitro-4-octoxyphenyl)benzoyl]oxyphenyl]-6-methoxycarbonylterephthalic acid |
|---|---|
| PubChem CID | 19033440 |
| Molecular Formula | C37H36N2O11 |
| Molecular Weight | 684.70 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 2-[4-[4-(2-amino-5-nitro-4-octoxyphenyl)benzoyl]oxyphenyl]-6-methoxycarbonylterephthalic acid |
| SMILES | CCCCCCCCOc1cc(N)c(-c2ccc(C(=O)Oc3ccc(-c4cc(C(=O)O)cc(C(=O)OC)c4C(=O)O)cc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C37H36N2O11/c1-3-4-5-6-7-8-17-49-32-21-30(38)27(20-31(32)39(46)47)22-9-11-24(12-10-22)36(44)50-26-15-13-23(14-16-26)28-18-25(34(40)41)19-29(37(45)48-2)33(28)35(42)43/h9-16,18-21H,3-8,17,38H2,1-2H3,(H,40,41)(H,42,43) |
| InChIKey | SODFHJWLKCYLEC-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 205.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.70 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|