C4H7N3O — CID 19033990
2-amino-1,3-dihydropyridazin-6-one (PubChem CID 19033990) has the molecular formula C4H7N3O and a molecular weight of 113.12 g/mol. Its IUPAC name is 2-amino-1,3-dihydropyridazin-6-one.
| Compound Name | 2-amino-1,3-dihydropyridazin-6-one |
|---|---|
| PubChem CID | 19033990 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 2-amino-1,3-dihydropyridazin-6-one |
| SMILES | NN1CC=CC(=O)N1 |
| InChI | InChI=1S/C4H7N3O/c5-7-3-1-2-4(8)6-7/h1-2H,3,5H2,(H,6,8) |
| InChIKey | OIPAECTWSXAOBJ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|