C19H44O4 — CID 19043654
1-butoxybutane;2-ethylhexan-1-ol;propane-1,2-diol (PubChem CID 19043654) has the molecular formula C19H44O4 and a molecular weight of 336.56 g/mol. Its IUPAC name is 1-butoxybutane;2-ethylhexan-1-ol;propane-1,2-diol.
| Compound Name | 1-butoxybutane;2-ethylhexan-1-ol;propane-1,2-diol |
|---|---|
| PubChem CID | 19043654 |
| Molecular Formula | C19H44O4 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.32 |
| IUPAC Name | 1-butoxybutane;2-ethylhexan-1-ol;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCC(CC)CO.CCCCOCCCC |
| InChI | InChI=1S/2C8H18O.C3H8O2/c1-3-5-6-8(4-2)7-9;1-3-5-7-9-8-6-4-2;1-3(5)2-4/h8-9H,3-7H2,1-2H3;3-8H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | HZRPSNLFCYRHMM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|