About 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene
1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene (PubChem CID 19049780) has the molecular formula C12H12N2S2
and a molecular weight of 248.38 g/mol. Its IUPAC name is 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene.
Molecular Properties
| Compound Name | 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene |
| PubChem CID | 19049780 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene |
| SMILES | Cc1ccc(C(CN=C=S)CN=C=S)cc1 |
| InChI | InChI=1S/C12H12N2S2/c1-10-2-4-11(5-3-10)12(6-13-8-15)7-14-9-16/h2-5,12H,6-7H2,1H3 |
| InChIKey | KELVQPFQOKXMTK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene?
The IUPAC name of 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene (CID 19049780) is 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene.
What is the SMILES notation for 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene?
The canonical SMILES for 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene is Cc1ccc(C(CN=C=S)CN=C=S)cc1.
What is the InChIKey of 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene?
The InChIKey is KELVQPFQOKXMTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S2/c1-10-2-4-11(5-3-10)12(6-13-8-15)7-14-9-16/h2-5,12H,6-7H2,1H3.
What are the key properties of 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene?
1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene has a molecular weight of 248.38 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-diisothiocyanatopropan-2-yl)-4-methylbenzene is sourced from PubChem (CID 19049780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).