C27H23N3O4S — CID 19058603
3-[4-[(3,4-dimethoxyphenyl)methylideneamino]phenyl]sulfanyl-1-(1H-indol-6-yl)pyrrolidine-2,5-dione (PubChem CID 19058603) has the molecular formula C27H23N3O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is 3-[4-[(3,4-dimethoxyphenyl)methylideneamino]phenyl]sulfanyl-1-(1H-indol-6-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-[(3,4-dimethoxyphenyl)methylideneamino]phenyl]sulfanyl-1-(1H-indol-6-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 19058603 |
| Molecular Formula | C27H23N3O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 3-[4-[(3,4-dimethoxyphenyl)methylideneamino]phenyl]sulfanyl-1-(1H-indol-6-yl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(/C=N/c2ccc(SC3CC(=O)N(c4ccc5cc[nH]c5c4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C27H23N3O4S/c1-33-23-10-3-17(13-24(23)34-2)16-29-19-5-8-21(9-6-19)35-25-15-26(31)30(27(25)32)20-7-4-18-11-12-28-22(18)14-20/h3-14,16,25,28H,15H2,1-2H3/b29-16+ |
| InChIKey | AGOFKTHYHZLCIW-MUFRIFMGSA-N |
| XLogP | 5.36 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|