C27H40O4Si — CID 19064091
4-[2-adamantylidene-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]butanoic acid (PubChem CID 19064091) has the molecular formula C27H40O4Si and a molecular weight of 456.70 g/mol. Its IUPAC name is 4-[2-adamantylidene-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]butanoic acid.
| Compound Name | 4-[2-adamantylidene-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]butanoic acid |
|---|---|
| PubChem CID | 19064091 |
| Molecular Formula | C27H40O4Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 4-[2-adamantylidene-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methoxy]butanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(C(OCCCC(=O)O)=C2C3CC4CC(C3)CC2C4)c1 |
| InChI | InChI=1S/C27H40O4Si/c1-27(2,3)32(4,5)31-23-9-6-8-20(17-23)26(30-11-7-10-24(28)29)25-21-13-18-12-19(15-21)16-22(25)14-18/h6,8-9,17-19,21-22H,7,10-16H2,1-5H3,(H,28,29)/b26-25- |
| InChIKey | UAPVGANVMXGGGT-QPLCGJKRSA-N |
| XLogP | 7.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|