C18H22Na2O5P — CID 59050383
CID 59050383 (PubChem CID 59050383) has the molecular formula C18H22Na2O5P and a molecular weight of 395.32 g/mol.
| Compound Name | CID 59050383 |
|---|---|
| PubChem CID | 59050383 |
| Molecular Formula | C18H22Na2O5P |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | — |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1cccc(OP(=O)([O-])O)c1.[Na+].[Na] |
| InChI | InChI=1S/C18H23O5P.2Na/c1-22-18(13-3-2-4-16(10-13)23-24(19,20)21)17-14-6-11-5-12(8-14)9-15(17)7-11;;/h2-4,10-12,14-15H,5-9H2,1H3,(H2,19,20,21);;/q;;+1/p-1/b18-17-;; |
| InChIKey | KMSGLWDIIULKLB-NSGFTINJSA-M |
| XLogP | -0.04 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|