About [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate
[3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate (PubChem CID 22952332) has the molecular formula C26H33N2O5P
and a molecular weight of 484.53 g/mol. Its IUPAC name is [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate.
Molecular Properties
| Compound Name | [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate |
| PubChem CID | 22952332 |
| Molecular Formula | C26H33N2O5P |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate |
| SMILES | CCCOC(=C1C2CC3CC(C2)CC1C3)c1cccc(OP(=O)(OCCC#N)OCCC#N)c1 |
| InChI | InChI=1S/C26H33N2O5P/c1-2-10-30-26(25-22-14-19-13-20(16-22)17-23(25)15-19)21-6-3-7-24(18-21)33-34(29,31-11-4-8-27)32-12-5-9-28/h3,6-7,18-20,22-23H,2,4-5,10-17H2,1H3/b26-25- |
| InChIKey | XUSUMHMDPVNDNV-QPLCGJKRSA-N |
| XLogP | 6.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate?
The IUPAC name of [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate (CID 22952332) is [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate.
What is the SMILES notation for [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate?
The canonical SMILES for [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate is CCCOC(=C1C2CC3CC(C2)CC1C3)c1cccc(OP(=O)(OCCC#N)OCCC#N)c1.
What is the InChIKey of [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate?
The InChIKey is XUSUMHMDPVNDNV-QPLCGJKRSA-N. The full InChI is InChI=1S/C26H33N2O5P/c1-2-10-30-26(25-22-14-19-13-20(16-22)17-23(25)15-19)21-6-3-7-24(18-21)33-34(29,31-11-4-8-27)32-12-5-9-28/h3,6-7,18-20,22-23H,2,4-5,10-17H2,1H3/b26-25-.
What are the key properties of [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate?
[3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate has a molecular weight of 484.53 g/mol, XLogP of 6.63, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-adamantylidene(propoxy)methyl]phenyl] bis(2-cyanoethyl) phosphate is sourced from PubChem (CID 22952332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).