C10H18N2 — CID 19069785
N,N-dimethyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine (PubChem CID 19069785) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,N-dimethyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine.
| Compound Name | N,N-dimethyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 19069785 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,N-dimethyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine |
| SMILES | CN(C)C1CCC=C2CNCC21 |
| InChI | InChI=1S/C10H18N2/c1-12(2)10-5-3-4-8-6-11-7-9(8)10/h4,9-11H,3,5-7H2,1-2H3 |
| InChIKey | HNJYZTCPSJLCQL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|