C13H20O2 — CID 19088213
4-(3-hydroxy-2,2-dimethylpropyl)-2,6-dimethylphenol (PubChem CID 19088213) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(3-hydroxy-2,2-dimethylpropyl)-2,6-dimethylphenol.
| Compound Name | 4-(3-hydroxy-2,2-dimethylpropyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 19088213 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-(3-hydroxy-2,2-dimethylpropyl)-2,6-dimethylphenol |
| SMILES | Cc1cc(CC(C)(C)CO)cc(C)c1O |
| InChI | InChI=1S/C13H20O2/c1-9-5-11(6-10(2)12(9)15)7-13(3,4)8-14/h5-6,14-15H,7-8H2,1-4H3 |
| InChIKey | DEFMJDSVLYCTHY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |