C21H21N3O4 — CID 19092118
2-[3-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propyl]isoindole-1,3-dione (PubChem CID 19092118) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[3-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19092118 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[3-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propyl]isoindole-1,3-dione |
| SMILES | O=C1COc2ccc(CCNCCCN3C(=O)c4ccccc4C3=O)cc2N1 |
| InChI | InChI=1S/C21H21N3O4/c25-19-13-28-18-7-6-14(12-17(18)23-19)8-10-22-9-3-11-24-20(26)15-4-1-2-5-16(15)21(24)27/h1-2,4-7,12,22H,3,8-11,13H2,(H,23,25) |
| InChIKey | HRYINJZIIUEVQM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|