C24H17ClN2O2S — CID 19092761
2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pyridin-2-yl-1,3-thiazole (PubChem CID 19092761) has the molecular formula C24H17ClN2O2S and a molecular weight of 432.93 g/mol. Its IUPAC name is 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pyridin-2-yl-1,3-thiazole.
| Compound Name | 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 19092761 |
| Molecular Formula | C24H17ClN2O2S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pyridin-2-yl-1,3-thiazole |
| SMILES | ClCc1ccccc1COc1ccc2oc(-c3nc(-c4ccccn4)cs3)cc2c1 |
| InChI | InChI=1S/C24H17ClN2O2S/c25-13-16-5-1-2-6-17(16)14-28-19-8-9-22-18(11-19)12-23(29-22)24-27-21(15-30-24)20-7-3-4-10-26-20/h1-12,15H,13-14H2 |
| InChIKey | PHJAOOYXXZDHRX-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|