C12H13FO4 — CID 19094454
hydroxymethyl 6-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 19094454) has the molecular formula C12H13FO4 and a molecular weight of 240.23 g/mol. Its IUPAC name is hydroxymethyl 6-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | hydroxymethyl 6-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 19094454 |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | hydroxymethyl 6-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CC1CC(C(=O)OCO)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C12H13FO4/c1-7-4-10(12(15)16-6-14)9-5-8(13)2-3-11(9)17-7/h2-3,5,7,10,14H,4,6H2,1H3 |
| InChIKey | SEFGOVZELJOKDM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|