C29H24ClN3O4S2 — CID 19117740
5-[4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile (PubChem CID 19117740) has the molecular formula C29H24ClN3O4S2 and a molecular weight of 578.12 g/mol. Its IUPAC name is 5-[4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117740 |
| Molecular Formula | C29H24ClN3O4S2 |
| Molecular Weight | 578.12 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 5-[4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyl]-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(C(=O)CCCN2C(=O)/C(=C/c3ccc(Cl)cc3)SC2=S)c(O)n(C(C)c2ccccc2)c(=O)c1C#N |
| InChI | InChI=1S/C29H24ClN3O4S2/c1-17-22(16-31)26(35)33(18(2)20-7-4-3-5-8-20)28(37)25(17)23(34)9-6-14-32-27(36)24(39-29(32)38)15-19-10-12-21(30)13-11-19/h3-5,7-8,10-13,15,18,37H,6,9,14H2,1-2H3/b24-15- |
| InChIKey | JGBNOPIECPDZJQ-IWIPYMOSSA-N |
| XLogP | 5.86 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.12 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|