C17H29N5O2 — CID 19139757
ethyl 1-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19139757) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19139757 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | ethyl 1-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCCCN(C)c1ncnc(N2CCCC(C(=O)OCC)C2)c1N |
| InChI | InChI=1S/C17H29N5O2/c1-4-6-9-21(3)15-14(18)16(20-12-19-15)22-10-7-8-13(11-22)17(23)24-5-2/h12-13H,4-11,18H2,1-3H3 |
| InChIKey | TUUQDOXMIAZJGI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |