C18H27N7O2 — CID 19142336
ethyl 1-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142336) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142336 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | ethyl 1-[5-amino-6-(3-imidazol-1-ylpropylamino)pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(NCCCn3ccnc3)c2N)C1 |
| InChI | InChI=1S/C18H27N7O2/c1-2-27-18(26)14-5-3-9-25(11-14)17-15(19)16(22-12-23-17)21-6-4-8-24-10-7-20-13-24/h7,10,12-14H,2-6,8-9,11,19H2,1H3,(H,21,22,23) |
| InChIKey | XGTDVFGXGPTBQS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|