C25H24BrNO4S — CID 19229109
ethyl 2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 19229109) has the molecular formula C25H24BrNO4S and a molecular weight of 514.44 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19229109 |
| Molecular Formula | C25H24BrNO4S |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | ethyl 2-[[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2C)csc1NC(=O)/C=C/c1cc(Br)ccc1OC |
| InChI | InChI=1S/C25H24BrNO4S/c1-5-31-25(29)23-20(19-9-6-15(2)12-16(19)3)14-32-24(23)27-22(28)11-7-17-13-18(26)8-10-21(17)30-4/h6-14H,5H2,1-4H3,(H,27,28)/b11-7+ |
| InChIKey | PMLRUYCTTXICQC-YRNVUSSQSA-N |
| XLogP | 6.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|