C23H19N5O7 — CID 19234056
2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;2,4,6-trinitrophenol (PubChem CID 19234056) has the molecular formula C23H19N5O7 and a molecular weight of 477.43 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;2,4,6-trinitrophenol.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 19234056 |
| Molecular Formula | C23H19N5O7 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[1,2-a]pyridine;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccn2cc(-c3ccc4c(c3)CCCC4)nc2c1 |
| InChI | InChI=1S/C17H16N2.C6H3N3O7/c1-2-6-14-11-15(9-8-13(14)5-1)16-12-19-10-4-3-7-17(19)18-16;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-4,7-12H,1-2,5-6H2;1-2,10H |
| InChIKey | ZUCYIMBDCJKQGM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|