C30H26BrN5O6S3 — CID 19247581
2-[(1R,8R,9R)-11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 19247581) has the molecular formula C30H26BrN5O6S3 and a molecular weight of 728.67 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 19247581 |
| Molecular Formula | C30H26BrN5O6S3 |
| Molecular Weight | 728.67 g/mol |
| Exact Mass | 727.02 |
| IUPAC Name | 2-[(1R,8R,9R)-11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CN(C)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3S[C@H]3C(=O)N(c4ccc(Br)cc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C30H26BrN5O6S3/c1-34(2)19-9-3-16(4-10-19)23-24-25(28(39)36(27(24)38)20-11-5-17(31)6-12-20)43-29-26(23)44-30(40)35(29)15-22(37)33-18-7-13-21(14-8-18)45(32,41)42/h3-14,23-25H,15H2,1-2H3,(H,33,37)(H2,32,41,42)/t23-,24-,25+/m0/s1 |
| InChIKey | FTASWQVPOVOWHL-CCDWMCETSA-N |
| XLogP | 3.82 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|