C20H10Cl2F4N4O2 — CID 19286635
5-(2,4-dichlorophenyl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-1,2-oxazole-3-carboxamide (PubChem CID 19286635) has the molecular formula C20H10Cl2F4N4O2 and a molecular weight of 485.22 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19286635 |
| Molecular Formula | C20H10Cl2F4N4O2 |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1)c1cc(-c2ccc(Cl)cc2Cl)on1 |
| InChI | InChI=1S/C20H10Cl2F4N4O2/c21-9-1-2-10(12(22)5-9)16-7-15(29-32-16)20(31)27-17-3-4-30(28-17)8-11-18(25)13(23)6-14(24)19(11)26/h1-7H,8H2,(H,27,28,31) |
| InChIKey | NVMYRAMKHBZKTK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|