C16H8ClF3N6O3 — CID 19328283
5-[3-chloro-5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 19328283) has the molecular formula C16H8ClF3N6O3 and a molecular weight of 424.73 g/mol. Its IUPAC name is 5-[3-chloro-5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[3-chloro-5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19328283 |
| Molecular Formula | C16H8ClF3N6O3 |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 5-[3-chloro-5-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(C(F)(F)F)n2nc(-c3nc(-c4ccc([N+](=O)[O-])cc4)no3)c(Cl)c2n1 |
| InChI | InChI=1S/C16H8ClF3N6O3/c1-7-6-10(16(18,19)20)25-14(21-7)11(17)12(23-25)15-22-13(24-29-15)8-2-4-9(5-3-8)26(27)28/h2-6H,1H3 |
| InChIKey | SOOMJTHOBPNSEX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 112.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|