C22H29Cl4N5O2 — CID 19363119
3-N-(diaminomethylidene)-5-(2,5-dichlorophenyl)-1-N-[3-(diethylamino)propyl]benzene-1,3-dicarboxamide;dihydrochloride (PubChem CID 19363119) has the molecular formula C22H29Cl4N5O2 and a molecular weight of 537.32 g/mol. Its IUPAC name is 3-N-(diaminomethylidene)-5-(2,5-dichlorophenyl)-1-N-[3-(diethylamino)propyl]benzene-1,3-dicarboxamide;dihydrochloride.
| Compound Name | 3-N-(diaminomethylidene)-5-(2,5-dichlorophenyl)-1-N-[3-(diethylamino)propyl]benzene-1,3-dicarboxamide;dihydrochloride |
|---|---|
| PubChem CID | 19363119 |
| Molecular Formula | C22H29Cl4N5O2 |
| Molecular Weight | 537.32 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 3-N-(diaminomethylidene)-5-(2,5-dichlorophenyl)-1-N-[3-(diethylamino)propyl]benzene-1,3-dicarboxamide;dihydrochloride |
| SMILES | CCN(CC)CCCNC(=O)c1cc(C(=O)N=C(N)N)cc(-c2cc(Cl)ccc2Cl)c1.Cl.Cl |
| InChI | InChI=1S/C22H27Cl2N5O2.2ClH/c1-3-29(4-2)9-5-8-27-20(30)15-10-14(18-13-17(23)6-7-19(18)24)11-16(12-15)21(31)28-22(25)26;;/h6-7,10-13H,3-5,8-9H2,1-2H3,(H,27,30)(H4,25,26,28,31);2*1H |
| InChIKey | DGLPGPARVOURCE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|