C16H17ClN2O4S2 — CID 19375905
ethyl 4-[3-chloro-4-(dimethylcarbamoylsulfanyl)-5-methoxyphenyl]-1,3-thiazole-2-carboxylate (PubChem CID 19375905) has the molecular formula C16H17ClN2O4S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is ethyl 4-[3-chloro-4-(dimethylcarbamoylsulfanyl)-5-methoxyphenyl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-[3-chloro-4-(dimethylcarbamoylsulfanyl)-5-methoxyphenyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 19375905 |
| Molecular Formula | C16H17ClN2O4S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | ethyl 4-[3-chloro-4-(dimethylcarbamoylsulfanyl)-5-methoxyphenyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(Cl)c(SC(=O)N(C)C)c(OC)c2)cs1 |
| InChI | InChI=1S/C16H17ClN2O4S2/c1-5-23-15(20)14-18-11(8-24-14)9-6-10(17)13(12(7-9)22-4)25-16(21)19(2)3/h6-8H,5H2,1-4H3 |
| InChIKey | RJQSYGIQWJSYBH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|