C24H29N3O10S — CID 19379298
1-[2-[4-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanyl]-3-oxooxan-2-yl]-4-oxoazetidin-3-yl]ethyl prop-2-enyl carbonate (PubChem CID 19379298) has the molecular formula C24H29N3O10S and a molecular weight of 551.57 g/mol. Its IUPAC name is 1-[2-[4-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanyl]-3-oxooxan-2-yl]-4-oxoazetidin-3-yl]ethyl prop-2-enyl carbonate.
| Compound Name | 1-[2-[4-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanyl]-3-oxooxan-2-yl]-4-oxoazetidin-3-yl]ethyl prop-2-enyl carbonate |
|---|---|
| PubChem CID | 19379298 |
| Molecular Formula | C24H29N3O10S |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 1-[2-[4-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanyl]-3-oxooxan-2-yl]-4-oxoazetidin-3-yl]ethyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC(C)C1C(=O)NC1C1OCCC(SCCNC(=O)OCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C24H29N3O10S/c1-3-10-35-24(31)37-14(2)18-19(26-22(18)29)21-20(28)17(8-11-34-21)38-12-9-25-23(30)36-13-15-4-6-16(7-5-15)27(32)33/h3-7,14,17-19,21H,1,8-13H2,2H3,(H,25,30)(H,26,29) |
| InChIKey | YTQLEFGXKQTGGC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|