C25H28ClFN2O2 — CID 19380966
N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2-fluoroethoxy)acetamide (PubChem CID 19380966) has the molecular formula C25H28ClFN2O2 and a molecular weight of 442.96 g/mol. Its IUPAC name is N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2-fluoroethoxy)acetamide.
| Compound Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2-fluoroethoxy)acetamide |
|---|---|
| PubChem CID | 19380966 |
| Molecular Formula | C25H28ClFN2O2 |
| Molecular Weight | 442.96 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2-fluoroethoxy)acetamide |
| SMILES | O=C(COCCF)NC1CCN(CC23CC(c4ccccc42)c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C25H28ClFN2O2/c26-17-5-6-20-21-14-25(23(20)13-17,22-4-2-1-3-19(21)22)16-29-10-7-18(8-11-29)28-24(30)15-31-12-9-27/h1-6,13,18,21H,7-12,14-16H2,(H,28,30) |
| InChIKey | NGLUHYHMAYCRGO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|