C25H26ClF3N2O2 — CID 19381061
N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 19381061) has the molecular formula C25H26ClF3N2O2 and a molecular weight of 478.94 g/mol. Its IUPAC name is N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 19381061 |
| Molecular Formula | C25H26ClF3N2O2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[1-[(4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)methyl]piperidin-4-yl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)NC1CCN(CC23CC(c4ccccc42)c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C25H26ClF3N2O2/c26-16-5-6-19-20-12-24(22(19)11-16,21-4-2-1-3-18(20)21)14-31-9-7-17(8-10-31)30-23(32)13-33-15-25(27,28)29/h1-6,11,17,20H,7-10,12-15H2,(H,30,32) |
| InChIKey | MBLUDKFGXBLORM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |