C19H21FO3S — CID 19382467
[4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanol (PubChem CID 19382467) has the molecular formula C19H21FO3S and a molecular weight of 348.44 g/mol. Its IUPAC name is [4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanol.
| Compound Name | [4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 19382467 |
| Molecular Formula | C19H21FO3S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanol |
| SMILES | COC1(c2cc(F)cc(Sc3ccc(CO)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C19H21FO3S/c1-22-19(6-8-23-9-7-19)15-10-16(20)12-18(11-15)24-17-4-2-14(13-21)3-5-17/h2-5,10-12,21H,6-9,13H2,1H3 |
| InChIKey | DIFLTOGVDWWCHV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |