C14H18N4O6 — CID 19385193
2-amino-N-[4-(3,5-dinitrophenyl)-2-methyl-4-oxobutan-2-yl]propanamide (PubChem CID 19385193) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is 2-amino-N-[4-(3,5-dinitrophenyl)-2-methyl-4-oxobutan-2-yl]propanamide.
| Compound Name | 2-amino-N-[4-(3,5-dinitrophenyl)-2-methyl-4-oxobutan-2-yl]propanamide |
|---|---|
| PubChem CID | 19385193 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-amino-N-[4-(3,5-dinitrophenyl)-2-methyl-4-oxobutan-2-yl]propanamide |
| SMILES | CC(N)C(=O)NC(C)(C)CC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N4O6/c1-8(15)13(20)16-14(2,3)7-12(19)9-4-10(17(21)22)6-11(5-9)18(23)24/h4-6,8H,7,15H2,1-3H3,(H,16,20) |
| InChIKey | GYPNJJAWLJMGDY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|