C14H18N4O6 — CID 154258479
N-[(2S)-2-amino-4,4-dimethylpentanoyl]-3,5-dinitrobenzamide (PubChem CID 154258479) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is N-[(2S)-2-amino-4,4-dimethylpentanoyl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2S)-2-amino-4,4-dimethylpentanoyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 154258479 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[(2S)-2-amino-4,4-dimethylpentanoyl]-3,5-dinitrobenzamide |
| SMILES | CC(C)(C)C[C@H](N)C(=O)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N4O6/c1-14(2,3)7-11(15)13(20)16-12(19)8-4-9(17(21)22)6-10(5-8)18(23)24/h4-6,11H,7,15H2,1-3H3,(H,16,19,20)/t11-/m0/s1 |
| InChIKey | WJGXJOSPEHLVFV-NSHDSACASA-N |
| XLogP | 1.52 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|