C14H16N5O6P — CID 19421404
1-(diethoxyphosphorylmethyl)-7-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one (PubChem CID 19421404) has the molecular formula C14H16N5O6P and a molecular weight of 381.29 g/mol. Its IUPAC name is 1-(diethoxyphosphorylmethyl)-7-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one.
| Compound Name | 1-(diethoxyphosphorylmethyl)-7-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 19421404 |
| Molecular Formula | C14H16N5O6P |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-(diethoxyphosphorylmethyl)-7-nitro-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one |
| SMILES | CCOP(=O)(Cc1nnc2c(=O)[nH]c3cc([N+](=O)[O-])ccc3n12)OCC |
| InChI | InChI=1S/C14H16N5O6P/c1-3-24-26(23,25-4-2)8-12-16-17-13-14(20)15-10-7-9(19(21)22)5-6-11(10)18(12)13/h5-7H,3-4,8H2,1-2H3,(H,15,20) |
| InChIKey | WOALGIJXYCWIGZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|