C11H17NO5S2 — CID 19434018
3-(1,3-dioxolan-2-yl)-N-(4-hydroxybutyl)thiophene-2-sulfonamide (PubChem CID 19434018) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)-N-(4-hydroxybutyl)thiophene-2-sulfonamide.
| Compound Name | 3-(1,3-dioxolan-2-yl)-N-(4-hydroxybutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 19434018 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)-N-(4-hydroxybutyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCCO)c1sccc1C1OCCO1 |
| InChI | InChI=1S/C11H17NO5S2/c13-5-2-1-4-12-19(14,15)11-9(3-8-18-11)10-16-6-7-17-10/h3,8,10,12-13H,1-2,4-7H2 |
| InChIKey | RFPXHHCPHSKVDW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|