C11H7Br2N5O5 — CID 19508577
4,5-dibromo-N-(4-methyl-3,5-dinitrophenyl)-1H-pyrazole-3-carboxamide (PubChem CID 19508577) has the molecular formula C11H7Br2N5O5 and a molecular weight of 449.02 g/mol. Its IUPAC name is 4,5-dibromo-N-(4-methyl-3,5-dinitrophenyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4,5-dibromo-N-(4-methyl-3,5-dinitrophenyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19508577 |
| Molecular Formula | C11H7Br2N5O5 |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | 4,5-dibromo-N-(4-methyl-3,5-dinitrophenyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)c2n[nH]c(Br)c2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7Br2N5O5/c1-4-6(17(20)21)2-5(3-7(4)18(22)23)14-11(19)9-8(12)10(13)16-15-9/h2-3H,1H3,(H,14,19)(H,15,16) |
| InChIKey | UBHJHAHHDSZNJW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|