C14H17F4N5O4 — CID 19519017
1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one (PubChem CID 19519017) has the molecular formula C14H17F4N5O4 and a molecular weight of 395.31 g/mol. Its IUPAC name is 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one.
| Compound Name | 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 19519017 |
| Molecular Formula | C14H17F4N5O4 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one |
| SMILES | Cc1nn(CC(C)C(=O)N2N=C(C(F)F)CC2(O)C(F)F)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17F4N5O4/c1-6(5-21-8(3)10(23(26)27)7(2)19-21)12(24)22-14(25,13(17)18)4-9(20-22)11(15)16/h6,11,13,25H,4-5H2,1-3H3 |
| InChIKey | JQMIQACFMWFAKW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|