C14H14N2O3 — CID 19540751
(E)-1-(2,4-dihydroxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one (PubChem CID 19540751) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19540751 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one |
| SMILES | Cc1cc(/C=C/C(=O)c2ccc(O)cc2O)n(C)n1 |
| InChI | InChI=1S/C14H14N2O3/c1-9-7-10(16(2)15-9)3-6-13(18)12-5-4-11(17)8-14(12)19/h3-8,17,19H,1-2H3/b6-3+ |
| InChIKey | KILXDBOLJGNNRN-ZZXKWVIFSA-N |
| XLogP | 2.04 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|