C11H12F3N3S — CID 19620821
5-cyclopropyl-1-(3-isothiocyanatopropyl)-3-(trifluoromethyl)pyrazole (PubChem CID 19620821) has the molecular formula C11H12F3N3S and a molecular weight of 275.30 g/mol. Its IUPAC name is 5-cyclopropyl-1-(3-isothiocyanatopropyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 5-cyclopropyl-1-(3-isothiocyanatopropyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 19620821 |
| Molecular Formula | C11H12F3N3S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-cyclopropyl-1-(3-isothiocyanatopropyl)-3-(trifluoromethyl)pyrazole |
| SMILES | FC(F)(F)c1cc(C2CC2)n(CCCN=C=S)n1 |
| InChI | InChI=1S/C11H12F3N3S/c12-11(13,14)10-6-9(8-2-3-8)17(16-10)5-1-4-15-7-18/h6,8H,1-5H2 |
| InChIKey | AJYUOCXKXUUTOZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|