C19H11Cl2I2NO4 — CID 19672634
[4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] propanoate (PubChem CID 19672634) has the molecular formula C19H11Cl2I2NO4 and a molecular weight of 642.01 g/mol. Its IUPAC name is [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] propanoate.
| Compound Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] propanoate |
|---|---|
| PubChem CID | 19672634 |
| Molecular Formula | C19H11Cl2I2NO4 |
| Molecular Weight | 642.01 g/mol |
| Exact Mass | 640.82 |
| IUPAC Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] propanoate |
| SMILES | CCC(=O)Oc1c(I)cc(/C=C2\N=C(c3ccc(Cl)c(Cl)c3)OC2=O)cc1I |
| InChI | InChI=1S/C19H11Cl2I2NO4/c1-2-16(25)27-17-13(22)5-9(6-14(17)23)7-15-19(26)28-18(24-15)10-3-4-11(20)12(21)8-10/h3-8H,2H2,1H3/b15-7- |
| InChIKey | GDMHJYQLWCVPPT-CHHVJCJISA-N |
| XLogP | 5.86 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.01 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|