C5H6N2O — CID 19708523
4-ethenyl-1,3-dihydroimidazol-2-one (PubChem CID 19708523) has the molecular formula C5H6N2O and a molecular weight of 110.12 g/mol. Its IUPAC name is 4-ethenyl-1,3-dihydroimidazol-2-one.
| Compound Name | 4-ethenyl-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 19708523 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 4-ethenyl-1,3-dihydroimidazol-2-one |
| SMILES | C=Cc1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H6N2O/c1-2-4-3-6-5(8)7-4/h2-3H,1H2,(H2,6,7,8) |
| InChIKey | LADNVFNFDHUFLU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |