About (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine
(Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine (PubChem CID 19734306) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine |
| PubChem CID | 19734306 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine |
| SMILES | CNC/C=C(\Oc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO3/c1-18-10-9-15(21-14-5-3-2-4-6-14)13-7-8-16-17(11-13)20-12-19-16/h2-9,11,18H,10,12H2,1H3/b15-9- |
| InChIKey | KKVZJBYVLPVHKP-DHDCSXOGSA-N |
| XLogP | 3.05 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine?
The IUPAC name of (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine (CID 19734306) is (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine.
What is the SMILES notation for (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine?
The canonical SMILES for (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine is CNC/C=C(\Oc1ccccc1)c1ccc2c(c1)OCO2.
What is the InChIKey of (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine?
The InChIKey is KKVZJBYVLPVHKP-DHDCSXOGSA-N. The full InChI is InChI=1S/C17H17NO3/c1-18-10-9-15(21-14-5-3-2-4-6-14)13-7-8-16-17(11-13)20-12-19-16/h2-9,11,18H,10,12H2,1H3/b15-9-.
What are the key properties of (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine?
(Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine has a molecular weight of 283.33 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(1,3-benzodioxol-5-yl)-N-methyl-3-phenoxyprop-2-en-1-amine is sourced from PubChem (CID 19734306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).