C18H19NO3 — CID 54039899
3-(1,3-benzodioxol-5-yloxy)-N,N-dimethyl-3-phenylprop-2-en-1-amine (PubChem CID 54039899) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxy)-N,N-dimethyl-3-phenylprop-2-en-1-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yloxy)-N,N-dimethyl-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 54039899 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxy)-N,N-dimethyl-3-phenylprop-2-en-1-amine |
| SMILES | CN(C)CC=C(Oc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-19(2)11-10-16(14-6-4-3-5-7-14)22-15-8-9-17-18(12-15)21-13-20-17/h3-10,12H,11,13H2,1-2H3 |
| InChIKey | LLOUUDHCYZFYLO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|