C24H24FN5O3 — CID 19753558
1-[2-[4-[1-(2-fluorophenyl)-5-nitroindol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidin-2-one (PubChem CID 19753558) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is 1-[2-[4-[1-(2-fluorophenyl)-5-nitroindol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[4-[1-(2-fluorophenyl)-5-nitroindol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 19753558 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-[2-[4-[1-(2-fluorophenyl)-5-nitroindol-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCN1CC=C(c2cn(-c3ccccc3F)c3ccc([N+](=O)[O-])cc23)CC1 |
| InChI | InChI=1S/C24H24FN5O3/c25-21-3-1-2-4-23(21)29-16-20(19-15-18(30(32)33)5-6-22(19)29)17-7-10-27(11-8-17)13-14-28-12-9-26-24(28)31/h1-7,15-16H,8-14H2,(H,26,31) |
| InChIKey | DVFBHANNQGYZKZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|