C22H36O7 — CID 19755869
methyl 7-[2-acetyloxy-2-(oxan-2-yloxy)-5-(2-oxoethyl)cyclopentyl]heptanoate (PubChem CID 19755869) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is methyl 7-[2-acetyloxy-2-(oxan-2-yloxy)-5-(2-oxoethyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[2-acetyloxy-2-(oxan-2-yloxy)-5-(2-oxoethyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 19755869 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | methyl 7-[2-acetyloxy-2-(oxan-2-yloxy)-5-(2-oxoethyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(CC=O)CCC1(OC(C)=O)OC1CCCCO1 |
| InChI | InChI=1S/C22H36O7/c1-17(24)28-22(29-21-11-7-8-16-27-21)14-12-18(13-15-23)19(22)9-5-3-4-6-10-20(25)26-2/h15,18-19,21H,3-14,16H2,1-2H3 |
| InChIKey | WBMWLQSKZAOKQA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|