About methanolate;2-methylbutylaluminum(2+)
methanolate;2-methylbutylaluminum(2+) (PubChem CID 19766055) has the molecular formula C7H17AlO2
and a molecular weight of 160.19 g/mol. Its IUPAC name is methanolate;2-methylbutylaluminum(2+).
Molecular Properties
| Compound Name | methanolate;2-methylbutylaluminum(2+) |
| PubChem CID | 19766055 |
| Molecular Formula | C7H17AlO2 |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | methanolate;2-methylbutylaluminum(2+) |
| SMILES | CCC(C)C[Al+2].C[O-].C[O-] |
| InChI | InChI=1S/C5H11.2CH3O.Al/c1-4-5(2)3;2*1-2;/h5H,2,4H2,1,3H3;2*1H3;/q;2*-1;+2 |
| InChIKey | BTGCVCDAMQNVKC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanolate;2-methylbutylaluminum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanolate;2-methylbutylaluminum(2+)?
The IUPAC name of methanolate;2-methylbutylaluminum(2+) (CID 19766055) is methanolate;2-methylbutylaluminum(2+).
What is the SMILES notation for methanolate;2-methylbutylaluminum(2+)?
The canonical SMILES for methanolate;2-methylbutylaluminum(2+) is CCC(C)C[Al+2].C[O-].C[O-].
What is the InChIKey of methanolate;2-methylbutylaluminum(2+)?
The InChIKey is BTGCVCDAMQNVKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.2CH3O.Al/c1-4-5(2)3;2*1-2;/h5H,2,4H2,1,3H3;2*1H3;/q;2*-1;+2.
What are the key properties of methanolate;2-methylbutylaluminum(2+)?
methanolate;2-methylbutylaluminum(2+) has a molecular weight of 160.19 g/mol, XLogP of -0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanolate;2-methylbutylaluminum(2+) is sourced from PubChem (CID 19766055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).