C60H111N9O3 — CID 19768379
2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 19768379) has the molecular formula C60H111N9O3 and a molecular weight of 1006.61 g/mol. Its IUPAC name is 2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19768379 |
| Molecular Formula | C60H111N9O3 |
| Molecular Weight | 1006.61 g/mol |
| Exact Mass | 1005.88 |
| IUPAC Name | 2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)nc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C60H111N9O3/c1-16-19-37-64(46-40-55(4,5)67(56(6,7)41-46)70-49-31-25-22-26-32-49)52-61-53(65(38-20-17-2)47-42-57(8,9)68(58(10,11)43-47)71-50-33-27-23-28-34-50)63-54(62-52)66(39-21-18-3)48-44-59(12,13)69(60(14,15)45-48)72-51-35-29-24-30-36-51/h46-51H,16-45H2,1-15H3 |
| InChIKey | BUSCCEJMFQWHHS-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.61 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |