C10H8N2O2 — CID 19772717
(2E,4E)-2-cyano-5-(1H-pyrrol-2-yl)penta-2,4-dienoic acid (PubChem CID 19772717) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-(1H-pyrrol-2-yl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-cyano-5-(1H-pyrrol-2-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 19772717 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (2E,4E)-2-cyano-5-(1H-pyrrol-2-yl)penta-2,4-dienoic acid |
| SMILES | N#C/C(=C\C=C\c1ccc[nH]1)C(=O)O |
| InChI | InChI=1S/C10H8N2O2/c11-7-8(10(13)14)3-1-4-9-5-2-6-12-9/h1-6,12H,(H,13,14)/b4-1+,8-3+ |
| InChIKey | IIBGXGBPRBEPRE-ZOVTWTBISA-N |
| XLogP | 1.56 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|