(2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid

C12H9NO2S — CID 19772826

IUPAC(2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid
SMILESN#C/C(=C\C=C\C=C\c1ccsc1)C(=O)O
InChIInChI=1S/C12H9NO2S/c13-8-11(12(14)15)5-3-1-2-4-10-6-7-16-9-10/h1-7,9H,(H,14,15)/b3-1+,4-2+,11-5+
InChIKeyJZUQGJCVBLZIAO-XCVFLYMDSA-N
MW231.28 g/mol
LogP2.85
Rot. Bonds4

About (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid

(2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid (PubChem CID 19772826) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid.

Molecular Properties

Compound Name(2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid
PubChem CID19772826
Molecular FormulaC12H9NO2S
Molecular Weight231.28 g/mol
Exact Mass231.04
IUPAC Name(2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid
SMILESN#C/C(=C\C=C\C=C\c1ccsc1)C(=O)O
InChIInChI=1S/C12H9NO2S/c13-8-11(12(14)15)5-3-1-2-4-10-6-7-16-9-10/h1-7,9H,(H,14,15)/b3-1+,4-2+,11-5+
InChIKeyJZUQGJCVBLZIAO-XCVFLYMDSA-N
XLogP2.85
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.28
LogP ≤ 52.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid?
The IUPAC name of (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid (CID 19772826) is (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid.
What is the SMILES notation for (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid?
The canonical SMILES for (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid is N#C/C(=C\C=C\C=C\c1ccsc1)C(=O)O.
What is the InChIKey of (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid?
The InChIKey is JZUQGJCVBLZIAO-XCVFLYMDSA-N. The full InChI is InChI=1S/C12H9NO2S/c13-8-11(12(14)15)5-3-1-2-4-10-6-7-16-9-10/h1-7,9H,(H,14,15)/b3-1+,4-2+,11-5+.
What are the key properties of (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid?
(2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid has a molecular weight of 231.28 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid is sourced from PubChem (CID 19772826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).