C12H9NO2S — CID 19772826
(2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid (PubChem CID 19772826) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 19772826 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | (2E,4E,6E)-2-cyano-7-thiophen-3-ylhepta-2,4,6-trienoic acid |
| SMILES | N#C/C(=C\C=C\C=C\c1ccsc1)C(=O)O |
| InChI | InChI=1S/C12H9NO2S/c13-8-11(12(14)15)5-3-1-2-4-10-6-7-16-9-10/h1-7,9H,(H,14,15)/b3-1+,4-2+,11-5+ |
| InChIKey | JZUQGJCVBLZIAO-XCVFLYMDSA-N |
| XLogP | 2.85 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|